C11H23NO — CID 134572918
2-methyl-2,3-di(propan-2-yl)-1,3-oxazinane (PubChem CID 134572918) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-methyl-2,3-di(propan-2-yl)-1,3-oxazinane.
| Compound Name | 2-methyl-2,3-di(propan-2-yl)-1,3-oxazinane |
|---|---|
| PubChem CID | 134572918 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2-methyl-2,3-di(propan-2-yl)-1,3-oxazinane |
| SMILES | CC(C)N1CCCOC1(C)C(C)C |
| InChI | InChI=1S/C11H23NO/c1-9(2)11(5)12(10(3)4)7-6-8-13-11/h9-10H,6-8H2,1-5H3 |
| InChIKey | IUXCLZKKOUOADR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |