C15H31N — CID 170386744
1-(3,3-dimethylpentyl)-3,3,5-trimethylpiperidine (PubChem CID 170386744) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is 1-(3,3-dimethylpentyl)-3,3,5-trimethylpiperidine.
| Compound Name | 1-(3,3-dimethylpentyl)-3,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 170386744 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 1-(3,3-dimethylpentyl)-3,3,5-trimethylpiperidine |
| SMILES | CCC(C)(C)CCN1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H31N/c1-7-14(3,4)8-9-16-11-13(2)10-15(5,6)12-16/h13H,7-12H2,1-6H3 |
| InChIKey | IMELFRSOOYFKCN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |