C9H19N — CID 177010091
(2S,4R)-2-ethyl-1,2,4-trimethylpyrrolidine (PubChem CID 177010091) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (2S,4R)-2-ethyl-1,2,4-trimethylpyrrolidine.
| Compound Name | (2S,4R)-2-ethyl-1,2,4-trimethylpyrrolidine |
|---|---|
| PubChem CID | 177010091 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (2S,4R)-2-ethyl-1,2,4-trimethylpyrrolidine |
| SMILES | CC[C@@]1(C)C[C@@H](C)CN1C |
| InChI | InChI=1S/C9H19N/c1-5-9(3)6-8(2)7-10(9)4/h8H,5-7H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | FNUPXSSRHXUYHC-BDAKNGLRSA-N |
| XLogP | 2.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |