C9H20N2 — CID 64844336
2-ethyl-1,2,5-trimethylpiperazine (PubChem CID 64844336) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-ethyl-1,2,5-trimethylpiperazine.
| Compound Name | 2-ethyl-1,2,5-trimethylpiperazine |
|---|---|
| PubChem CID | 64844336 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 2-ethyl-1,2,5-trimethylpiperazine |
| SMILES | CCC1(C)CNC(C)CN1C |
| InChI | InChI=1S/C9H20N2/c1-5-9(3)7-10-8(2)6-11(9)4/h8,10H,5-7H2,1-4H3 |
| InChIKey | IBFXPQJCZJXHFI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |