C16H31NO2 — CID 170388193
[3-[3,3-dimethylbutyl(methyl)amino]-2,2-dimethylpropyl] 2-methylprop-2-enoate (PubChem CID 170388193) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is [3-[3,3-dimethylbutyl(methyl)amino]-2,2-dimethylpropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3,3-dimethylbutyl(methyl)amino]-2,2-dimethylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170388193 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | [3-[3,3-dimethylbutyl(methyl)amino]-2,2-dimethylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)CN(C)CCC(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-13(2)14(18)19-12-16(6,7)11-17(8)10-9-15(3,4)5/h1,9-12H2,2-8H3 |
| InChIKey | CIHUPBJFSOSGIF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|