C20H33N3O6 — CID 170391351
4-[(2-amino-5-oxohexanoyl)amino]-N-(2,6-dioxoheptan-3-yl)-6-oxoheptanamide (PubChem CID 170391351) has the molecular formula C20H33N3O6 and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-[(2-amino-5-oxohexanoyl)amino]-N-(2,6-dioxoheptan-3-yl)-6-oxoheptanamide.
| Compound Name | 4-[(2-amino-5-oxohexanoyl)amino]-N-(2,6-dioxoheptan-3-yl)-6-oxoheptanamide |
|---|---|
| PubChem CID | 170391351 |
| Molecular Formula | C20H33N3O6 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-[(2-amino-5-oxohexanoyl)amino]-N-(2,6-dioxoheptan-3-yl)-6-oxoheptanamide |
| SMILES | CC(=O)CCC(N)C(=O)NC(CCC(=O)NC(CCC(C)=O)C(C)=O)CC(C)=O |
| InChI | InChI=1S/C20H33N3O6/c1-12(24)5-8-17(21)20(29)22-16(11-14(3)26)7-10-19(28)23-18(15(4)27)9-6-13(2)25/h16-18H,5-11,21H2,1-4H3,(H,22,29)(H,23,28) |
| InChIKey | PARPILVWJOGNNM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |