C20H29N3O5S — CID 170391367
2-[[3-(4-hydroxyphenyl)-2-[5-(1,2-thiazolidin-5-yl)pentanoylamino]propanoyl]amino]propanoic acid (PubChem CID 170391367) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-[[3-(4-hydroxyphenyl)-2-[5-(1,2-thiazolidin-5-yl)pentanoylamino]propanoyl]amino]propanoic acid.
| Compound Name | 2-[[3-(4-hydroxyphenyl)-2-[5-(1,2-thiazolidin-5-yl)pentanoylamino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 170391367 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[[3-(4-hydroxyphenyl)-2-[5-(1,2-thiazolidin-5-yl)pentanoylamino]propanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)CCCCC1CCNS1)C(=O)O |
| InChI | InChI=1S/C20H29N3O5S/c1-13(20(27)28)22-19(26)17(12-14-6-8-15(24)9-7-14)23-18(25)5-3-2-4-16-10-11-21-29-16/h6-9,13,16-17,21,24H,2-5,10-12H2,1H3,(H,22,26)(H,23,25)(H,27,28) |
| InChIKey | VZTWBDKHNVHOMC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|