C20H33NO2S — CID 170392078
N-[1-(4-hydroxyphenyl)propan-2-yl]-6-methylsulfanyldecanamide (PubChem CID 170392078) has the molecular formula C20H33NO2S and a molecular weight of 351.56 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)propan-2-yl]-6-methylsulfanyldecanamide.
| Compound Name | N-[1-(4-hydroxyphenyl)propan-2-yl]-6-methylsulfanyldecanamide |
|---|---|
| PubChem CID | 170392078 |
| Molecular Formula | C20H33NO2S |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)propan-2-yl]-6-methylsulfanyldecanamide |
| SMILES | CCCCC(CCCCC(=O)NC(C)Cc1ccc(O)cc1)SC |
| InChI | InChI=1S/C20H33NO2S/c1-4-5-8-19(24-3)9-6-7-10-20(23)21-16(2)15-17-11-13-18(22)14-12-17/h11-14,16,19,22H,4-10,15H2,1-3H3,(H,21,23) |
| InChIKey | IYYJQJJQSFXWSI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|