C12H17N2O7P — CID 170392422
[2-[4-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl] methyl hydrogen phosphate (PubChem CID 170392422) has the molecular formula C12H17N2O7P and a molecular weight of 332.25 g/mol. Its IUPAC name is [2-[4-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl] methyl hydrogen phosphate.
| Compound Name | [2-[4-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 170392422 |
| Molecular Formula | C12H17N2O7P |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [2-[4-[(2-methoxyacetyl)amino]anilino]-2-oxoethyl] methyl hydrogen phosphate |
| SMILES | COCC(=O)Nc1ccc(NC(=O)COP(=O)(O)OC)cc1 |
| InChI | InChI=1S/C12H17N2O7P/c1-19-7-11(15)13-9-3-5-10(6-4-9)14-12(16)8-21-22(17,18)20-2/h3-6H,7-8H2,1-2H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | WNGDYEWAMGQEBE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|