C9H10F5NO2S — CID 177288026
2-methoxy-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]acetamide (PubChem CID 177288026) has the molecular formula C9H10F5NO2S and a molecular weight of 291.24 g/mol. Its IUPAC name is 2-methoxy-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 177288026 |
| Molecular Formula | C9H10F5NO2S |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-methoxy-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C9H10F5NO2S/c1-17-6-9(16)15-7-2-4-8(5-3-7)18(10,11,12,13)14/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | KXCDUERBWPHHSD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |