C10H10F5NO3S — CID 86691876
[2-oxo-2-[4-(pentafluoro-λ6-sulfanyl)anilino]ethyl] acetate (PubChem CID 86691876) has the molecular formula C10H10F5NO3S and a molecular weight of 319.25 g/mol. Its IUPAC name is [2-oxo-2-[4-(pentafluoro-λ6-sulfanyl)anilino]ethyl] acetate.
| Compound Name | [2-oxo-2-[4-(pentafluoro-λ6-sulfanyl)anilino]ethyl] acetate |
|---|---|
| PubChem CID | 86691876 |
| Molecular Formula | C10H10F5NO3S |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | [2-oxo-2-[4-(pentafluoro-λ6-sulfanyl)anilino]ethyl] acetate |
| SMILES | CC(=O)OCC(=O)Nc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F5NO3S/c1-7(17)19-6-10(18)16-8-2-4-9(5-3-8)20(11,12,13,14)15/h2-5H,6H2,1H3,(H,16,18) |
| InChIKey | GGLFFYMIYZWEHK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |