About 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine
3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine (PubChem CID 170394374) has the molecular formula C10H16ClN
and a molecular weight of 185.70 g/mol. Its IUPAC name is 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine.
Molecular Properties
| Compound Name | 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine |
| PubChem CID | 170394374 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine |
| SMILES | CC12CCC(C(Cl)=C1N)C2(C)C |
| InChI | InChI=1S/C10H16ClN/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6H,4-5,12H2,1-3H3 |
| InChIKey | PCAVPIABEZGQBM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine?
The IUPAC name of 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine (CID 170394374) is 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine.
What is the SMILES notation for 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine?
The canonical SMILES for 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine is CC12CCC(C(Cl)=C1N)C2(C)C.
What is the InChIKey of 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine?
The InChIKey is PCAVPIABEZGQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6H,4-5,12H2,1-3H3.
What are the key properties of 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine?
3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine has a molecular weight of 185.70 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine is sourced from PubChem (CID 170394374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).