C28H29N4O4PS — CID 170405301
6-(2,6-dimethylphenyl)-10-(4-dimethylphosphorylphenyl)-9-oxa-2λ6-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene 2,2-dioxide (PubChem CID 170405301) has the molecular formula C28H29N4O4PS and a molecular weight of 548.61 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)-10-(4-dimethylphosphorylphenyl)-9-oxa-2λ6-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene 2,2-dioxide.
| Compound Name | 6-(2,6-dimethylphenyl)-10-(4-dimethylphosphorylphenyl)-9-oxa-2λ6-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene 2,2-dioxide |
|---|---|
| PubChem CID | 170405301 |
| Molecular Formula | C28H29N4O4PS |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 6-(2,6-dimethylphenyl)-10-(4-dimethylphosphorylphenyl)-9-oxa-2λ6-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene 2,2-dioxide |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)(=O)c1cccc(c1)NCC(c1ccc(P(C)(C)=O)cc1)O2 |
| InChI | InChI=1S/C28H29N4O4PS/c1-18-7-5-8-19(2)27(18)24-16-26-31-28(30-24)32-38(34,35)23-10-6-9-21(15-23)29-17-25(36-26)20-11-13-22(14-12-20)37(3,4)33/h5-16,25,29H,17H2,1-4H3,(H,30,31,32) |
| InChIKey | VRAANOHHXIPLLJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|