C28H25BrN4O4S — CID 166998425
10-(4-bromophenyl)-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one (PubChem CID 166998425) has the molecular formula C28H25BrN4O4S and a molecular weight of 593.50 g/mol. Its IUPAC name is 10-(4-bromophenyl)-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one.
| Compound Name | 10-(4-bromophenyl)-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one |
|---|---|
| PubChem CID | 166998425 |
| Molecular Formula | C28H25BrN4O4S |
| Molecular Weight | 593.50 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | 10-(4-bromophenyl)-6-(2,6-dimethylphenyl)-2,2-dioxo-9-oxa-2λ6-thia-3,5,12,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)(=O)c1cccc(c1)C(=O)CNCC(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C28H25BrN4O4S/c1-17-5-3-6-18(2)27(17)23-14-26-32-28(31-23)33-38(35,36)22-8-4-7-20(13-22)24(34)15-30-16-25(37-26)19-9-11-21(29)12-10-19/h3-14,25,30H,15-16H2,1-2H3,(H,31,32,33) |
| InChIKey | RQFHTGDBSMKHHJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |