C25H25N3O2S — CID 170406769
2-(benzenesulfonamido)-N,N-dibenzyl-N'-ethenylprop-2-enimidamide (PubChem CID 170406769) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N,N-dibenzyl-N'-ethenylprop-2-enimidamide.
| Compound Name | 2-(benzenesulfonamido)-N,N-dibenzyl-N'-ethenylprop-2-enimidamide |
|---|---|
| PubChem CID | 170406769 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-(benzenesulfonamido)-N,N-dibenzyl-N'-ethenylprop-2-enimidamide |
| SMILES | C=C/N=C(/C(=C)NS(=O)(=O)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H25N3O2S/c1-3-26-25(21(2)27-31(29,30)24-17-11-6-12-18-24)28(19-22-13-7-4-8-14-22)20-23-15-9-5-10-16-23/h3-18,27H,1-2,19-20H2/b26-25- |
| InChIKey | PXPMPUKWTWOWFW-QPLCGJKRSA-N |
| XLogP | 4.72 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|