C34H39ClFN5O2 — CID 170409099
(1E,3E)-4-[6-chloro-4-(9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol (PubChem CID 170409099) has the molecular formula C34H39ClFN5O2 and a molecular weight of 604.17 g/mol. Its IUPAC name is (1E,3E)-4-[6-chloro-4-(9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol.
| Compound Name | (1E,3E)-4-[6-chloro-4-(9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 170409099 |
| Molecular Formula | C34H39ClFN5O2 |
| Molecular Weight | 604.17 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | (1E,3E)-4-[6-chloro-4-(9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol |
| SMILES | C/C(=C\C(O)=C/c1ccccc1C)c1c(Cl)cc2c(N3C4CCC3C3CCC4N3)nc(OC[C@@H]3CCCN3C)nc2c1F |
| InChI | InChI=1S/C34H39ClFN5O2/c1-19-7-4-5-8-21(19)16-23(42)15-20(2)30-25(35)17-24-32(31(30)36)38-34(43-18-22-9-6-14-40(22)3)39-33(24)41-28-12-13-29(41)27-11-10-26(28)37-27/h4-5,7-8,15-17,22,26-29,37,42H,6,9-14,18H2,1-3H3/b20-15+,23-16+/t22-,26?,27?,28?,29?/m0/s1 |
| InChIKey | WUSFZOHSBBATBE-CUHWYYPCSA-N |
| XLogP | 6.68 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.17 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|