C32H39ClFN5O — CID 170409122
(1E,3E)-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(dimethylamino)butyl]-8-fluoroquinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol (PubChem CID 170409122) has the molecular formula C32H39ClFN5O and a molecular weight of 564.15 g/mol. Its IUPAC name is (1E,3E)-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(dimethylamino)butyl]-8-fluoroquinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol.
| Compound Name | (1E,3E)-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(dimethylamino)butyl]-8-fluoroquinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 170409122 |
| Molecular Formula | C32H39ClFN5O |
| Molecular Weight | 564.15 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | (1E,3E)-4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(dimethylamino)butyl]-8-fluoroquinazolin-7-yl]-1-(2-methylphenyl)penta-1,3-dien-2-ol |
| SMILES | C/C(=C\C(O)=C/c1ccccc1C)c1c(Cl)cc2c(N3CC4CCC(C3)N4)nc(CCCCN(C)C)nc2c1F |
| InChI | InChI=1S/C32H39ClFN5O/c1-20-9-5-6-10-22(20)16-25(40)15-21(2)29-27(33)17-26-31(30(29)34)36-28(11-7-8-14-38(3)4)37-32(26)39-18-23-12-13-24(19-39)35-23/h5-6,9-10,15-17,23-24,35,40H,7-8,11-14,18-19H2,1-4H3/b21-15+,25-16+ |
| InChIKey | JOQJVZXZJVAAOY-UPXQHGRYSA-N |
| XLogP | 6.56 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.15 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|