C29H33ClFN5 — CID 170114953
5-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-[(1E,3Z)-4-phenylbuta-1,3-dienyl]quinazolin-2-yl]pentan-1-amine (PubChem CID 170114953) has the molecular formula C29H33ClFN5 and a molecular weight of 506.07 g/mol. Its IUPAC name is 5-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-[(1E,3Z)-4-phenylbuta-1,3-dienyl]quinazolin-2-yl]pentan-1-amine.
| Compound Name | 5-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-[(1E,3Z)-4-phenylbuta-1,3-dienyl]quinazolin-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 170114953 |
| Molecular Formula | C29H33ClFN5 |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 5-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-[(1E,3Z)-4-phenylbuta-1,3-dienyl]quinazolin-2-yl]pentan-1-amine |
| SMILES | NCCCCCc1nc(N2CC3CCC(C2)N3)c2cc(Cl)c(/C=C/C=C\c3ccccc3)c(F)c2n1 |
| InChI | InChI=1S/C29H33ClFN5/c30-25-17-24-28(27(31)23(25)12-7-6-11-20-9-3-1-4-10-20)34-26(13-5-2-8-16-32)35-29(24)36-18-21-14-15-22(19-36)33-21/h1,3-4,6-7,9-12,17,21-22,33H,2,5,8,13-16,18-19,32H2/b11-6-,12-7+ |
| InChIKey | CECZWKFUKZMSAL-TWTKIJFOSA-N |
| XLogP | 5.76 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|