C27H38N5O4S- — CID 170409498
4-[(2R)-3-cyclohexyl-2-(piperidine-1-carbonylamino)propoxy]-6-(2,6-dimethylphenyl)-2-(sulfinatoamino)pyrimidine (PubChem CID 170409498) has the molecular formula C27H38N5O4S- and a molecular weight of 528.70 g/mol. Its IUPAC name is 4-[(2R)-3-cyclohexyl-2-(piperidine-1-carbonylamino)propoxy]-6-(2,6-dimethylphenyl)-2-(sulfinatoamino)pyrimidine.
| Compound Name | 4-[(2R)-3-cyclohexyl-2-(piperidine-1-carbonylamino)propoxy]-6-(2,6-dimethylphenyl)-2-(sulfinatoamino)pyrimidine |
|---|---|
| PubChem CID | 170409498 |
| Molecular Formula | C27H38N5O4S- |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 4-[(2R)-3-cyclohexyl-2-(piperidine-1-carbonylamino)propoxy]-6-(2,6-dimethylphenyl)-2-(sulfinatoamino)pyrimidine |
| SMILES | Cc1cccc(C)c1-c1cc(OC[C@@H](CC2CCCCC2)NC(=O)N2CCCCC2)nc(NS(=O)[O-])n1 |
| InChI | InChI=1S/C27H39N5O4S/c1-19-10-9-11-20(2)25(19)23-17-24(30-26(29-23)31-37(34)35)36-18-22(16-21-12-5-3-6-13-21)28-27(33)32-14-7-4-8-15-32/h9-11,17,21-22H,3-8,12-16,18H2,1-2H3,(H,28,33)(H,34,35)(H,29,30,31)/p-1/t22-/m1/s1 |
| InChIKey | OQALTLVOMMPPQN-JOCHJYFZSA-M |
| XLogP | 4.88 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|