About N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride
N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride (PubChem CID 170412066) has the molecular formula C6H8FN3O
and a molecular weight of 157.15 g/mol. Its IUPAC name is N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride.
Molecular Properties
| Compound Name | N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride |
| PubChem CID | 170412066 |
| Molecular Formula | C6H8FN3O |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride |
| SMILES | Cc1cn(C)nc1NC(=O)F |
| InChI | InChI=1S/C6H8FN3O/c1-4-3-10(2)9-5(4)8-6(7)11/h3H,1-2H3,(H,8,9,11) |
| InChIKey | ZSQIAIIFSWUEFC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride?
The IUPAC name of N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride (CID 170412066) is N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride.
What is the SMILES notation for N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride?
The canonical SMILES for N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride is Cc1cn(C)nc1NC(=O)F.
What is the InChIKey of N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride?
The InChIKey is ZSQIAIIFSWUEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FN3O/c1-4-3-10(2)9-5(4)8-6(7)11/h3H,1-2H3,(H,8,9,11).
What are the key properties of N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride?
N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride has a molecular weight of 157.15 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dimethylpyrazol-3-yl)carbamoyl fluoride is sourced from PubChem (CID 170412066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).