C7H11F3N2 — CID 170414993
(Z)-1,1,1-trifluoro-3-(methyliminomethyl)pent-2-en-2-amine (PubChem CID 170414993) has the molecular formula C7H11F3N2 and a molecular weight of 180.17 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-3-(methyliminomethyl)pent-2-en-2-amine.
| Compound Name | (Z)-1,1,1-trifluoro-3-(methyliminomethyl)pent-2-en-2-amine |
|---|---|
| PubChem CID | 170414993 |
| Molecular Formula | C7H11F3N2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (Z)-1,1,1-trifluoro-3-(methyliminomethyl)pent-2-en-2-amine |
| SMILES | CCC(/C=N/C)=C(/N)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2/c1-3-5(4-12-2)6(11)7(8,9)10/h4H,3,11H2,1-2H3/b6-5-,12-4+ |
| InChIKey | MRKYCGGLJGMADB-JWUPWDRQSA-N |
| XLogP | 1.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|