C27H36N6O3S — CID 170417153
N-(4,5-dimethyl-1,2-oxazol-3-yl)-6-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]piperidin-1-yl]cyclohexa-1,5-diene-1-sulfonamide (PubChem CID 170417153) has the molecular formula C27H36N6O3S and a molecular weight of 524.69 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,2-oxazol-3-yl)-6-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]piperidin-1-yl]cyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-6-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]piperidin-1-yl]cyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 170417153 |
| Molecular Formula | C27H36N6O3S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-6-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]piperidin-1-yl]cyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CCc1nc2c(C)cc(C)nc2n1CC1CCN(C2=CCCC=C2S(=O)(=O)Nc2noc(C)c2C)CC1 |
| InChI | InChI=1S/C27H36N6O3S/c1-6-24-29-25-17(2)15-18(3)28-27(25)33(24)16-21-11-13-32(14-12-21)22-9-7-8-10-23(22)37(34,35)31-26-19(4)20(5)36-30-26/h9-10,15,21H,6-8,11-14,16H2,1-5H3,(H,30,31) |
| InChIKey | SOAMIOIIDQPTKS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |