C26H28N6O4S — CID 25051649
N-(4,5-dimethyl-1,2-oxazol-3-yl)-4-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-methyl-1,2-oxazole-5-sulfonamide (PubChem CID 25051649) has the molecular formula C26H28N6O4S and a molecular weight of 520.62 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,2-oxazol-3-yl)-4-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-methyl-1,2-oxazole-5-sulfonamide.
| Compound Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-4-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-methyl-1,2-oxazole-5-sulfonamide |
|---|---|
| PubChem CID | 25051649 |
| Molecular Formula | C26H28N6O4S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-4-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-methyl-1,2-oxazole-5-sulfonamide |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2c(C)noc2S(=O)(=O)Nc2noc(C)c2C)cc1 |
| InChI | InChI=1S/C26H28N6O4S/c1-7-21-28-23-14(2)12-15(3)27-25(23)32(21)13-19-8-10-20(11-9-19)22-17(5)29-36-26(22)37(33,34)31-24-16(4)18(6)35-30-24/h8-12H,7,13H2,1-6H3,(H,30,31) |
| InChIKey | QVYKEDFRNYXOFH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |