C17H15ClF3N3O4 — CID 170418738
[2-(trifluoromethyl)-4-pyridinyl] 2-chloro-6-(oxan-4-ylmethoxy)pyrimidine-4-carboxylate (PubChem CID 170418738) has the molecular formula C17H15ClF3N3O4 and a molecular weight of 417.77 g/mol. Its IUPAC name is [2-(trifluoromethyl)-4-pyridinyl] 2-chloro-6-(oxan-4-ylmethoxy)pyrimidine-4-carboxylate.
| Compound Name | [2-(trifluoromethyl)-4-pyridinyl] 2-chloro-6-(oxan-4-ylmethoxy)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 170418738 |
| Molecular Formula | C17H15ClF3N3O4 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | [2-(trifluoromethyl)-4-pyridinyl] 2-chloro-6-(oxan-4-ylmethoxy)pyrimidine-4-carboxylate |
| SMILES | O=C(Oc1ccnc(C(F)(F)F)c1)c1cc(OCC2CCOCC2)nc(Cl)n1 |
| InChI | InChI=1S/C17H15ClF3N3O4/c18-16-23-12(8-14(24-16)27-9-10-2-5-26-6-3-10)15(25)28-11-1-4-22-13(7-11)17(19,20)21/h1,4,7-8,10H,2-3,5-6,9H2 |
| InChIKey | FRUQTZLJSGRVHY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |