C16H17ClF3N3O2 — CID 175728673
2-chloro-6-(oxan-4-ylmethoxy)-1-[2-(trifluoromethyl)-4-pyridinyl]-2H-pyrimidine (PubChem CID 175728673) has the molecular formula C16H17ClF3N3O2 and a molecular weight of 375.78 g/mol. Its IUPAC name is 2-chloro-6-(oxan-4-ylmethoxy)-1-[2-(trifluoromethyl)-4-pyridinyl]-2H-pyrimidine.
| Compound Name | 2-chloro-6-(oxan-4-ylmethoxy)-1-[2-(trifluoromethyl)-4-pyridinyl]-2H-pyrimidine |
|---|---|
| PubChem CID | 175728673 |
| Molecular Formula | C16H17ClF3N3O2 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-chloro-6-(oxan-4-ylmethoxy)-1-[2-(trifluoromethyl)-4-pyridinyl]-2H-pyrimidine |
| SMILES | FC(F)(F)c1cc(N2C(OCC3CCOCC3)=CC=NC2Cl)ccn1 |
| InChI | InChI=1S/C16H17ClF3N3O2/c17-15-22-6-2-14(25-10-11-3-7-24-8-4-11)23(15)12-1-5-21-13(9-12)16(18,19)20/h1-2,5-6,9,11,15H,3-4,7-8,10H2 |
| InChIKey | WKXSNYGWVHMKKG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|