C11H20N4O5S — CID 170419932
(2R,3R,4R,5S,6S)-5-[[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (PubChem CID 170419932) has the molecular formula C11H20N4O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-5-[[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S,6S)-5-[[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 170419932 |
| Molecular Formula | C11H20N4O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2R,3R,4R,5S,6S)-5-[[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@@H]1Nc1nc(N(C)C)ns1 |
| InChI | InChI=1S/C11H20N4O5S/c1-15(2)10-13-11(21-14-10)12-6-8(18)7(17)5(4-16)20-9(6)19-3/h5-9,16-18H,4H2,1-3H3,(H,12,13,14)/t5-,6+,7+,8-,9+/m1/s1 |
| InChIKey | VWGGVBWCUBAOGG-NXRLNHOXSA-N |
| XLogP | -1.53 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |