C9H14ClN3O4S — CID 167221600
(2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methyloxane-3,4-diol (PubChem CID 167221600) has the molecular formula C9H14ClN3O4S and a molecular weight of 295.75 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methyloxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 167221600 |
| Molecular Formula | C9H14ClN3O4S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methyloxane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1nc(Cl)ns1 |
| InChI | InChI=1S/C9H14ClN3O4S/c1-3-5(11-9-12-8(10)13-18-9)7(16)6(15)4(2-14)17-3/h3-7,14-16H,2H2,1H3,(H,11,12,13)/t3-,4+,5-,6-,7+/m0/s1 |
| InChIKey | BFWNVPQTXABWDJ-MLKOFDEISA-N |
| XLogP | -0.53 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |