C12H16F3N3O4 — CID 176760332
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 176760332) has the molecular formula C12H16F3N3O4 and a molecular weight of 323.27 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 176760332 |
| Molecular Formula | C12H16F3N3O4 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F3N3O4/c1-5-9(11(21)10(20)6(4-19)22-5)18-8-3-16-2-7(17-8)12(13,14)15/h2-3,5-6,9-11,19-21H,4H2,1H3,(H,17,18)/t5-,6+,9-,10-,11+/m0/s1 |
| InChIKey | CBBTYEYEMWBVMO-RQOSQENXSA-N |
| XLogP | -0.22 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |