C9H12ClN3O4S — CID 174026616
(1S,2R,3R,4R,5R)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 174026616) has the molecular formula C9H12ClN3O4S and a molecular weight of 293.73 g/mol. Its IUPAC name is (1S,2R,3R,4R,5R)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5R)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 174026616 |
| Molecular Formula | C9H12ClN3O4S |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | (1S,2R,3R,4R,5R)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-methyl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | C[C@@]12CO[C@H](O1)[C@H](Nc1nc(Cl)ns1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C9H12ClN3O4S/c1-9-2-16-6(17-9)3(4(14)5(9)15)11-8-12-7(10)13-18-8/h3-6,14-15H,2H2,1H3,(H,11,12,13)/t3-,4-,5-,6-,9+/m1/s1 |
| InChIKey | GQJRAHONQSJHEG-OPUYAHJXSA-N |
| XLogP | -0.16 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |