C29H21N3O2 — CID 170422622
N-[6-(4-benzamidophenyl)-3-pyridinyl]naphthalene-1-carboxamide (PubChem CID 170422622) has the molecular formula C29H21N3O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[6-(4-benzamidophenyl)-3-pyridinyl]naphthalene-1-carboxamide.
| Compound Name | N-[6-(4-benzamidophenyl)-3-pyridinyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 170422622 |
| Molecular Formula | C29H21N3O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-[6-(4-benzamidophenyl)-3-pyridinyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccc(NC(=O)c3cccc4ccccc34)cn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H21N3O2/c33-28(22-8-2-1-3-9-22)31-23-15-13-21(14-16-23)27-18-17-24(19-30-27)32-29(34)26-12-6-10-20-7-4-5-11-25(20)26/h1-19H,(H,31,33)(H,32,34) |
| InChIKey | XYVQTGAZBZCTCH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |