About 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene
7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene (PubChem CID 170422680) has the molecular formula C16H23Cl
and a molecular weight of 250.81 g/mol. Its IUPAC name is 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene.
Molecular Properties
| Compound Name | 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene |
| PubChem CID | 170422680 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene |
| SMILES | Cc1ccc(Cl)c2c1C(C(C)C)(C(C)C)CC2 |
| InChI | InChI=1S/C16H23Cl/c1-10(2)16(11(3)4)9-8-13-14(17)7-6-12(5)15(13)16/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | UWXSMCGPVVIPIO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene?
The IUPAC name of 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene (CID 170422680) is 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene.
What is the SMILES notation for 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene?
The canonical SMILES for 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene is Cc1ccc(Cl)c2c1C(C(C)C)(C(C)C)CC2.
What is the InChIKey of 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene?
The InChIKey is UWXSMCGPVVIPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl/c1-10(2)16(11(3)4)9-8-13-14(17)7-6-12(5)15(13)16/h6-7,10-11H,8-9H2,1-5H3.
What are the key properties of 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene?
7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene has a molecular weight of 250.81 g/mol, XLogP of 5.14, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-methyl-3,3-di(propan-2-yl)-1,2-dihydroindene is sourced from PubChem (CID 170422680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).