C16H23N5O — CID 170422932
amino-[3-[3-(2-aminoethyl)anilino]-6-ethyl-5-methylpyrazin-2-yl]methanol (PubChem CID 170422932) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is amino-[3-[3-(2-aminoethyl)anilino]-6-ethyl-5-methylpyrazin-2-yl]methanol.
| Compound Name | amino-[3-[3-(2-aminoethyl)anilino]-6-ethyl-5-methylpyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 170422932 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | amino-[3-[3-(2-aminoethyl)anilino]-6-ethyl-5-methylpyrazin-2-yl]methanol |
| SMILES | CCc1nc(C(N)O)c(Nc2cccc(CCN)c2)nc1C |
| InChI | InChI=1S/C16H23N5O/c1-3-13-10(2)19-16(14(21-13)15(18)22)20-12-6-4-5-11(9-12)7-8-17/h4-6,9,15,22H,3,7-8,17-18H2,1-2H3,(H,19,20) |
| InChIKey | USVQVGDPDVOGEO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|