C21H30ClN5O3 — CID 168970557
tert-butyl N-[(2R)-2-[3-[[3-[amino(hydroxy)methyl]-6-chloro-5-ethylpyrazin-2-yl]amino]phenyl]propyl]carbamate (PubChem CID 168970557) has the molecular formula C21H30ClN5O3 and a molecular weight of 435.96 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[3-[[3-[amino(hydroxy)methyl]-6-chloro-5-ethylpyrazin-2-yl]amino]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[3-[[3-[amino(hydroxy)methyl]-6-chloro-5-ethylpyrazin-2-yl]amino]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 168970557 |
| Molecular Formula | C21H30ClN5O3 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl N-[(2R)-2-[3-[[3-[amino(hydroxy)methyl]-6-chloro-5-ethylpyrazin-2-yl]amino]phenyl]propyl]carbamate |
| SMILES | CCc1nc(C(N)O)c(Nc2cccc([C@@H](C)CNC(=O)OC(C)(C)C)c2)nc1Cl |
| InChI | InChI=1S/C21H30ClN5O3/c1-6-15-17(22)27-19(16(26-15)18(23)28)25-14-9-7-8-13(10-14)12(2)11-24-20(29)30-21(3,4)5/h7-10,12,18,28H,6,11,23H2,1-5H3,(H,24,29)(H,25,27)/t12-,18?/m0/s1 |
| InChIKey | KFPJUYHAWADPRI-RSXQAXDFSA-N |
| XLogP | 4.01 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|