C28H48OS — CID 170426806
(1S,2R,11S,12S,15R,16R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-methylsulfanyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane (PubChem CID 170426806) has the molecular formula C28H48OS and a molecular weight of 432.76 g/mol. Its IUPAC name is (1S,2R,11S,12S,15R,16R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-methylsulfanyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane.
| Compound Name | (1S,2R,11S,12S,15R,16R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-methylsulfanyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane |
|---|---|
| PubChem CID | 170426806 |
| Molecular Formula | C28H48OS |
| Molecular Weight | 432.76 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (1S,2R,11S,12S,15R,16R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-methylsulfanyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane |
| SMILES | CSC1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C(C)CCCC(C)C)CC[C@H]4[C@@H]3CC3OC32C1 |
| InChI | InChI=1S/C28H48OS/c1-18(2)8-7-9-19(3)22-10-11-23-21-16-25-28(29-25)17-20(30-6)12-15-27(28,5)24(21)13-14-26(22,23)4/h18-25H,7-17H2,1-6H3/t19?,20?,21-,22+,23-,24-,25?,26+,27+,28?/m0/s1 |
| InChIKey | WIAGVKFFBIQAKW-LSVQFMPESA-N |
| XLogP | 7.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.76 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|