C26H27ClN4O3S — CID 170428851
1-[[7-[6-[(3S,5R)-1-chloro-5-(hydroxymethyl)pyrrolidin-3-yl]-1,2,3,4-tetrahydroquinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 170428851) has the molecular formula C26H27ClN4O3S and a molecular weight of 511.05 g/mol. Its IUPAC name is 1-[[7-[6-[(3S,5R)-1-chloro-5-(hydroxymethyl)pyrrolidin-3-yl]-1,2,3,4-tetrahydroquinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[7-[6-[(3S,5R)-1-chloro-5-(hydroxymethyl)pyrrolidin-3-yl]-1,2,3,4-tetrahydroquinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 170428851 |
| Molecular Formula | C26H27ClN4O3S |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 1-[[7-[6-[(3S,5R)-1-chloro-5-(hydroxymethyl)pyrrolidin-3-yl]-1,2,3,4-tetrahydroquinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1Cc1cc2nccc(-c3cc([C@@H]4C[C@H](CO)N(Cl)C4)cc4c3NCCC4)c2s1 |
| InChI | InChI=1S/C26H27ClN4O3S/c27-31-12-17(9-18(31)14-32)16-8-15-2-1-6-29-25(15)21(10-16)20-5-7-28-22-11-19(35-26(20)22)13-30-23(33)3-4-24(30)34/h5,7-8,10-11,17-18,29,32H,1-4,6,9,12-14H2/t17-,18-/m1/s1 |
| InChIKey | VNYJNIGGYINJFJ-QZTJIDSGSA-N |
| XLogP | 4.27 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|