C30H32ClN3O4S — CID 170428915
5-[[7-[1-[(7S)-5-azaspiro[3.4]octan-7-yl]-6-chloro-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 170428915) has the molecular formula C30H32ClN3O4S and a molecular weight of 566.12 g/mol. Its IUPAC name is 5-[[7-[1-[(7S)-5-azaspiro[3.4]octan-7-yl]-6-chloro-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[7-[1-[(7S)-5-azaspiro[3.4]octan-7-yl]-6-chloro-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 170428915 |
| Molecular Formula | C30H32ClN3O4S |
| Molecular Weight | 566.12 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 5-[[7-[1-[(7S)-5-azaspiro[3.4]octan-7-yl]-6-chloro-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(Cc2cc3nccc(-c4cc(Cl)cc5c4N([C@@H]4CNC6(CCC6)C4)CCC5)c3s2)C(=O)O1 |
| InChI | InChI=1S/C30H32ClN3O4S/c1-29(2)37-27(35)23(28(36)38-29)13-20-14-24-26(39-20)21(6-9-32-24)22-12-18(31)11-17-5-3-10-34(25(17)22)19-15-30(33-16-19)7-4-8-30/h6,9,11-12,14,19,23,33H,3-5,7-8,10,13,15-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | DZUFDFSVJNVJGS-IBGZPJMESA-N |
| XLogP | 5.65 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.12 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|