C30H31ClN4O3S — CID 170428934
3-[[7-[4-(5-azaspiro[3.4]octan-7-yl)-7-chloro-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 170428934) has the molecular formula C30H31ClN4O3S and a molecular weight of 563.12 g/mol. Its IUPAC name is 3-[[7-[4-(5-azaspiro[3.4]octan-7-yl)-7-chloro-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[7-[4-(5-azaspiro[3.4]octan-7-yl)-7-chloro-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 170428934 |
| Molecular Formula | C30H31ClN4O3S |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 3-[[7-[4-(5-azaspiro[3.4]octan-7-yl)-7-chloro-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C2C(=O)N(Cc3cc4nccc(-c5cc(Cl)cc6c5N(C5CNC7(CCC7)C5)CCO6)c4s3)C(=O)C21 |
| InChI | InChI=1S/C30H31ClN4O3S/c1-29(2)23-24(29)28(37)35(27(23)36)15-18-12-21-26(39-18)19(4-7-32-21)20-10-16(31)11-22-25(20)34(8-9-38-22)17-13-30(33-14-17)5-3-6-30/h4,7,10-12,17,23-24,33H,3,5-6,8-9,13-15H2,1-2H3 |
| InChIKey | ORGHAMJTGBIFIG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|