C25H24ClN3O5S — CID 171575119
1-[[7-[7-chloro-4-[(3R,5S)-5-(hydroxymethyl)oxolan-3-yl]-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 171575119) has the molecular formula C25H24ClN3O5S and a molecular weight of 514.00 g/mol. Its IUPAC name is 1-[[7-[7-chloro-4-[(3R,5S)-5-(hydroxymethyl)oxolan-3-yl]-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[7-[7-chloro-4-[(3R,5S)-5-(hydroxymethyl)oxolan-3-yl]-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 171575119 |
| Molecular Formula | C25H24ClN3O5S |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 1-[[7-[7-chloro-4-[(3R,5S)-5-(hydroxymethyl)oxolan-3-yl]-2,3-dihydro-1,4-benzoxazin-5-yl]thieno[3,2-b]pyridin-2-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1Cc1cc2nccc(-c3cc(Cl)cc4c3N([C@H]3CO[C@H](CO)C3)CCO4)c2s1 |
| InChI | InChI=1S/C25H24ClN3O5S/c26-14-7-19(24-21(8-14)33-6-5-28(24)15-9-16(12-30)34-13-15)18-3-4-27-20-10-17(35-25(18)20)11-29-22(31)1-2-23(29)32/h3-4,7-8,10,15-16,30H,1-2,5-6,9,11-13H2/t15-,16+/m1/s1 |
| InChIKey | KGBLCWTZSJOFNP-CVEARBPZSA-N |
| XLogP | 3.61 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|