C33H31ClFN7O4 — CID 170430281
[(1S,6R,7R)-3-[3-(5-chloro-1-oxo-2H-isoquinolin-6-yl)-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methylcarbamic acid (PubChem CID 170430281) has the molecular formula C33H31ClFN7O4 and a molecular weight of 644.11 g/mol. Its IUPAC name is [(1S,6R,7R)-3-[3-(5-chloro-1-oxo-2H-isoquinolin-6-yl)-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methylcarbamic acid.
| Compound Name | [(1S,6R,7R)-3-[3-(5-chloro-1-oxo-2H-isoquinolin-6-yl)-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 170430281 |
| Molecular Formula | C33H31ClFN7O4 |
| Molecular Weight | 644.11 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | [(1S,6R,7R)-3-[3-(5-chloro-1-oxo-2H-isoquinolin-6-yl)-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-7-yl]methylcarbamic acid |
| SMILES | O=C(O)NC[C@]1(c2ccccc2F)[C@@H]2CCN(c3cnc4c(-c5ccc6c(=O)[nH]ccc6c5Cl)nn(C5CCCCO5)c4n3)C[C@@H]21 |
| InChI | InChI=1S/C33H31ClFN7O4/c34-27-18-10-12-36-31(43)19(18)8-9-20(27)28-29-30(42(40-28)26-7-3-4-14-46-26)39-25(15-37-29)41-13-11-21-23(16-41)33(21,17-38-32(44)45)22-5-1-2-6-24(22)35/h1-2,5-6,8-10,12,15,21,23,26,38H,3-4,7,11,13-14,16-17H2,(H,36,43)(H,44,45)/t21-,23+,26?,33-/m1/s1 |
| InChIKey | SWSMJJKLTGKXQK-SAKMXSGZSA-N |
| XLogP | 5.49 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.11 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |