C32H40F2N8O2 — CID 170433694
2-[(2R,5S)-2-ethyl-4-[2-hydrazinyl-8-methyl-9-(oxolan-2-ylmethyl)purin-6-yl]-5-methylpiperazin-1-yl]-2,2-bis(4-fluorophenyl)ethanol (PubChem CID 170433694) has the molecular formula C32H40F2N8O2 and a molecular weight of 606.72 g/mol. Its IUPAC name is 2-[(2R,5S)-2-ethyl-4-[2-hydrazinyl-8-methyl-9-(oxolan-2-ylmethyl)purin-6-yl]-5-methylpiperazin-1-yl]-2,2-bis(4-fluorophenyl)ethanol.
| Compound Name | 2-[(2R,5S)-2-ethyl-4-[2-hydrazinyl-8-methyl-9-(oxolan-2-ylmethyl)purin-6-yl]-5-methylpiperazin-1-yl]-2,2-bis(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 170433694 |
| Molecular Formula | C32H40F2N8O2 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 2-[(2R,5S)-2-ethyl-4-[2-hydrazinyl-8-methyl-9-(oxolan-2-ylmethyl)purin-6-yl]-5-methylpiperazin-1-yl]-2,2-bis(4-fluorophenyl)ethanol |
| SMILES | CC[C@@H]1CN(c2nc(NN)nc3c2nc(C)n3CC2CCCO2)[C@@H](C)CN1C(CO)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H40F2N8O2/c1-4-26-17-40(29-28-30(38-31(37-29)39-35)41(21(3)36-28)18-27-6-5-15-44-27)20(2)16-42(26)32(19-43,22-7-11-24(33)12-8-22)23-9-13-25(34)14-10-23/h7-14,20,26-27,43H,4-6,15-19,35H2,1-3H3,(H,37,38,39)/t20-,26+,27?/m0/s1 |
| InChIKey | NBXRSDSTUWLXDI-OAVDKCEPSA-N |
| XLogP | 4.10 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|