C29H42F2N8O2 — CID 170433766
[6-[(2S,5R)-4-[1-[4-(difluoromethoxy)phenyl]-2-methylpropyl]-5-ethyl-2-methylpiperazin-1-yl]-8-methyl-9-(oxolan-2-ylmethyl)purin-2-yl]hydrazine (PubChem CID 170433766) has the molecular formula C29H42F2N8O2 and a molecular weight of 572.71 g/mol. Its IUPAC name is [6-[(2S,5R)-4-[1-[4-(difluoromethoxy)phenyl]-2-methylpropyl]-5-ethyl-2-methylpiperazin-1-yl]-8-methyl-9-(oxolan-2-ylmethyl)purin-2-yl]hydrazine.
| Compound Name | [6-[(2S,5R)-4-[1-[4-(difluoromethoxy)phenyl]-2-methylpropyl]-5-ethyl-2-methylpiperazin-1-yl]-8-methyl-9-(oxolan-2-ylmethyl)purin-2-yl]hydrazine |
|---|---|
| PubChem CID | 170433766 |
| Molecular Formula | C29H42F2N8O2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | [6-[(2S,5R)-4-[1-[4-(difluoromethoxy)phenyl]-2-methylpropyl]-5-ethyl-2-methylpiperazin-1-yl]-8-methyl-9-(oxolan-2-ylmethyl)purin-2-yl]hydrazine |
| SMILES | CC[C@@H]1CN(c2nc(NN)nc3c2nc(C)n3CC2CCCO2)[C@@H](C)CN1C(c1ccc(OC(F)F)cc1)C(C)C |
| InChI | InChI=1S/C29H42F2N8O2/c1-6-21-15-37(18(4)14-39(21)25(17(2)3)20-9-11-22(12-10-20)41-28(30)31)26-24-27(35-29(34-26)36-32)38(19(5)33-24)16-23-8-7-13-40-23/h9-12,17-18,21,23,25,28H,6-8,13-16,32H2,1-5H3,(H,34,35,36)/t18-,21+,23?,25?/m0/s1 |
| InChIKey | HDPHTQVIFWPIMJ-FULKDMDPSA-N |
| XLogP | 4.89 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|