C28H37BrN8O — CID 170434951
4-[(2S,5R)-4-[(1R)-1-(4-bromophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170434951) has the molecular formula C28H37BrN8O and a molecular weight of 581.56 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(1R)-1-(4-bromophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[(1R)-1-(4-bromophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170434951 |
| Molecular Formula | C28H37BrN8O |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 4-[(2S,5R)-4-[(1R)-1-(4-bromophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine |
| SMILES | Cc1nc2c(N3C[C@@H](C)N([C@@H](c4ccc(Br)cc4)C(C)C)C[C@@H]3C)nc3nncn3c2n1CC1CCCO1 |
| InChI | InChI=1S/C28H37BrN8O/c1-17(2)25(21-8-10-22(29)11-9-21)34-13-19(4)35(14-18(34)3)26-24-27(37-16-30-33-28(37)32-26)36(20(5)31-24)15-23-7-6-12-38-23/h8-11,16-19,23,25H,6-7,12-15H2,1-5H3/t18-,19+,23?,25-/m1/s1 |
| InChIKey | BUQNCXGFSHNDHM-MCMANRHISA-N |
| XLogP | 5.02 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |