C29H40N8O2 — CID 170433533
4-[(2S,5R)-4-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433533) has the molecular formula C29H40N8O2 and a molecular weight of 532.69 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433533 |
| Molecular Formula | C29H40N8O2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | 4-[(2S,5R)-4-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine |
| SMILES | COc1ccc([C@@H](C(C)C)N2C[C@H](C)N(c3nc4nncn4c4c3nc(C)n4CC3CCCO3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C29H40N8O2/c1-18(2)26(22-9-11-23(38-6)12-10-22)34-14-20(4)35(15-19(34)3)27-25-28(37-17-30-33-29(37)32-27)36(21(5)31-25)16-24-8-7-13-39-24/h9-12,17-20,24,26H,7-8,13-16H2,1-6H3/t19-,20+,24?,26-/m1/s1 |
| InChIKey | UVMBFEKKONTVNW-NSYSXTDGSA-N |
| XLogP | 4.27 |
| TPSA | 85.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |