C28H36ClFN8O — CID 170433853
4-[(2S,5R)-4-[(1S)-1-(3-chloro-4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433853) has the molecular formula C28H36ClFN8O and a molecular weight of 555.10 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(1S)-1-(3-chloro-4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[(1S)-1-(3-chloro-4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433853 |
| Molecular Formula | C28H36ClFN8O |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 4-[(2S,5R)-4-[(1S)-1-(3-chloro-4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
| SMILES | Cc1nc2c(N3C[C@@H](C)N([C@H](c4ccc(F)c(Cl)c4)C(C)C)C[C@@H]3C)nc3nncn3c2n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C28H36ClFN8O/c1-16(2)25(20-8-9-23(30)22(29)11-20)35-12-18(4)36(13-17(35)3)26-24-27(38-15-31-34-28(38)33-26)37(19(5)32-24)14-21-7-6-10-39-21/h8-9,11,15-18,21,25H,6-7,10,12-14H2,1-5H3/t17-,18+,21+,25+/m1/s1 |
| InChIKey | KGVPYAPLPQTCGD-DTOBJMFKSA-N |
| XLogP | 5.05 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |