C29H33ClF4N8O — CID 170433808
4-[(2S,5R)-4-[(3-chloro-2,4-difluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433808) has the molecular formula C29H33ClF4N8O and a molecular weight of 621.08 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(3-chloro-2,4-difluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[(3-chloro-2,4-difluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433808 |
| Molecular Formula | C29H33ClF4N8O |
| Molecular Weight | 621.08 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 4-[(2S,5R)-4-[(3-chloro-2,4-difluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
| SMILES | Cc1nc2c(N3C[C@@H](C)N(C(c4ccc(F)c(Cl)c4F)C4CC(F)(F)C4)C[C@@H]3C)nc3nncn3c2n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C29H33ClF4N8O/c1-15-12-40(16(2)11-39(15)25(18-9-29(33,34)10-18)20-6-7-21(31)22(30)23(20)32)26-24-27(42-14-35-38-28(42)37-26)41(17(3)36-24)13-19-5-4-8-43-19/h6-7,14-16,18-19,25H,4-5,8-13H2,1-3H3/t15-,16+,19+,25?/m1/s1 |
| InChIKey | FQGQGFHJPIIKPQ-WUUCQRFQSA-N |
| XLogP | 5.58 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.08 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|