C29H34BrF3N8O — CID 170433012
4-[(2S,5R)-4-[(3-bromo-4-fluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433012) has the molecular formula C29H34BrF3N8O and a molecular weight of 647.54 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(3-bromo-4-fluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[(3-bromo-4-fluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433012 |
| Molecular Formula | C29H34BrF3N8O |
| Molecular Weight | 647.54 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 4-[(2S,5R)-4-[(3-bromo-4-fluorophenyl)-(3,3-difluorocyclobutyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-(oxolan-2-ylmethyl)-[1,2,4]triazolo[3,4-b]purine |
| SMILES | Cc1nc2c(N3C[C@@H](C)N(C(c4ccc(F)c(Br)c4)C4CC(F)(F)C4)C[C@@H]3C)nc3nncn3c2n1CC1CCCO1 |
| InChI | InChI=1S/C29H34BrF3N8O/c1-16-13-39(17(2)12-38(16)25(20-10-29(32,33)11-20)19-6-7-23(31)22(30)9-19)26-24-27(41-15-34-37-28(41)36-26)40(18(3)35-24)14-21-5-4-8-42-21/h6-7,9,15-17,20-21,25H,4-5,8,10-14H2,1-3H3/t16-,17+,21?,25?/m1/s1 |
| InChIKey | CKVKXOCCPOKHOG-FVHHZMEASA-N |
| XLogP | 5.55 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |