C17H16Cl2N2O3 — CID 170433966
(2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(3-formylphenyl)methyl]butanamide (PubChem CID 170433966) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(3-formylphenyl)methyl]butanamide.
| Compound Name | (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(3-formylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 170433966 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(3-formylphenyl)methyl]butanamide |
| SMILES | CC[C@@H](Oc1ncc(Cl)cc1Cl)C(=O)NCc1cccc(C=O)c1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-2-15(24-17-14(19)7-13(18)9-21-17)16(23)20-8-11-4-3-5-12(6-11)10-22/h3-7,9-10,15H,2,8H2,1H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | QBCYDBVQUPRTGB-OAHLLOKOSA-N |
| XLogP | 3.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|