C24H28Cl2N6O4 — CID 170612628
N-[[3-[6-[(2E)-2-amino-2-hydroxyiminoethyl]-2,6-diazaspiro[3.3]heptane-2-carbonyl]phenyl]methyl]-2-[(3,5-dichloro-2-pyridinyl)oxy]butanamide (PubChem CID 170612628) has the molecular formula C24H28Cl2N6O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is N-[[3-[6-[(2E)-2-amino-2-hydroxyiminoethyl]-2,6-diazaspiro[3.3]heptane-2-carbonyl]phenyl]methyl]-2-[(3,5-dichloro-2-pyridinyl)oxy]butanamide.
| Compound Name | N-[[3-[6-[(2E)-2-amino-2-hydroxyiminoethyl]-2,6-diazaspiro[3.3]heptane-2-carbonyl]phenyl]methyl]-2-[(3,5-dichloro-2-pyridinyl)oxy]butanamide |
|---|---|
| PubChem CID | 170612628 |
| Molecular Formula | C24H28Cl2N6O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | N-[[3-[6-[(2E)-2-amino-2-hydroxyiminoethyl]-2,6-diazaspiro[3.3]heptane-2-carbonyl]phenyl]methyl]-2-[(3,5-dichloro-2-pyridinyl)oxy]butanamide |
| SMILES | CCC(Oc1ncc(Cl)cc1Cl)C(=O)NCc1cccc(C(=O)N2CC3(CN(C/C(N)=N\O)C3)C2)c1 |
| InChI | InChI=1S/C24H28Cl2N6O4/c1-2-19(36-22-18(26)7-17(25)9-29-22)21(33)28-8-15-4-3-5-16(6-15)23(34)32-13-24(14-32)11-31(12-24)10-20(27)30-35/h3-7,9,19,35H,2,8,10-14H2,1H3,(H2,27,30)(H,28,33) |
| InChIKey | UHIILLUSYRQLOM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|