C20H33BrN2O2 — CID 170434919
3-(4-bromohexan-3-yloxy)-N-[3-(tert-butylamino)propyl]benzamide (PubChem CID 170434919) has the molecular formula C20H33BrN2O2 and a molecular weight of 413.40 g/mol. Its IUPAC name is 3-(4-bromohexan-3-yloxy)-N-[3-(tert-butylamino)propyl]benzamide.
| Compound Name | 3-(4-bromohexan-3-yloxy)-N-[3-(tert-butylamino)propyl]benzamide |
|---|---|
| PubChem CID | 170434919 |
| Molecular Formula | C20H33BrN2O2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-(4-bromohexan-3-yloxy)-N-[3-(tert-butylamino)propyl]benzamide |
| SMILES | CCC(Br)C(CC)Oc1cccc(C(=O)NCCCNC(C)(C)C)c1 |
| InChI | InChI=1S/C20H33BrN2O2/c1-6-17(21)18(7-2)25-16-11-8-10-15(14-16)19(24)22-12-9-13-23-20(3,4)5/h8,10-11,14,17-18,23H,6-7,9,12-13H2,1-5H3,(H,22,24) |
| InChIKey | WAROZNGXSGOXFM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|