C34H20ClF5N4O4 — CID 170435293
N-[4-(2-chloro-5-fluorophenoxy)-3-(1,3-dioxoisoindol-2-yl)-7-ethenyl-1-prop-2-enylindazol-5-yl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 170435293) has the molecular formula C34H20ClF5N4O4 and a molecular weight of 679.00 g/mol. Its IUPAC name is N-[4-(2-chloro-5-fluorophenoxy)-3-(1,3-dioxoisoindol-2-yl)-7-ethenyl-1-prop-2-enylindazol-5-yl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(2-chloro-5-fluorophenoxy)-3-(1,3-dioxoisoindol-2-yl)-7-ethenyl-1-prop-2-enylindazol-5-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170435293 |
| Molecular Formula | C34H20ClF5N4O4 |
| Molecular Weight | 679.00 g/mol |
| Exact Mass | 678.11 |
| IUPAC Name | N-[4-(2-chloro-5-fluorophenoxy)-3-(1,3-dioxoisoindol-2-yl)-7-ethenyl-1-prop-2-enylindazol-5-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | C=CCn1nc(N2C(=O)c3ccccc3C2=O)c2c(Oc3cc(F)ccc3Cl)c(NC(=O)c3cc(F)cc(C(F)(F)F)c3)cc(C=C)c21 |
| InChI | InChI=1S/C34H20ClF5N4O4/c1-3-11-43-28-17(4-2)14-25(41-31(45)18-12-19(34(38,39)40)15-21(37)13-18)29(48-26-16-20(36)9-10-24(26)35)27(28)30(42-43)44-32(46)22-7-5-6-8-23(22)33(44)47/h3-10,12-16H,1-2,11H2,(H,41,45) |
| InChIKey | WURLOMKJPHCRHE-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.00 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|